C29H44N6O7S2 — CID 90883912
[1-[4-[2-[2-acetamido-5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1,3-thiazol-4-yl]ethyl]anilino]-1-carbamoyloxy-2,2-dimethylpropyl] N-tert-butylcarbamate (PubChem CID 90883912) has the molecular formula C29H44N6O7S2 and a molecular weight of 652.84 g/mol. Its IUPAC name is [1-[4-[2-[2-acetamido-5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1,3-thiazol-4-yl]ethyl]anilino]-1-carbamoyloxy-2,2-dimethylpropyl] N-tert-butylcarbamate.
| Compound Name | [1-[4-[2-[2-acetamido-5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1,3-thiazol-4-yl]ethyl]anilino]-1-carbamoyloxy-2,2-dimethylpropyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90883912 |
| Molecular Formula | C29H44N6O7S2 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | [1-[4-[2-[2-acetamido-5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1,3-thiazol-4-yl]ethyl]anilino]-1-carbamoyloxy-2,2-dimethylpropyl] N-tert-butylcarbamate |
| SMILES | CC(=O)Nc1nc(CCc2ccc(NC(OC(N)=O)(OC(=O)NC(C)(C)C)C(C)(C)C)cc2)c(CN2CCS(=O)(=O)CC2)s1 |
| InChI | InChI=1S/C29H44N6O7S2/c1-19(36)31-25-32-22(23(43-25)18-35-14-16-44(39,40)17-15-35)13-10-20-8-11-21(12-9-20)33-29(27(2,3)4,41-24(30)37)42-26(38)34-28(5,6)7/h8-9,11-12,33H,10,13-18H2,1-7H3,(H2,30,37)(H,34,38)(H,31,32,36) |
| InChIKey | AWLOYNTVHKHGMH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 182.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|