C11H18N2O6S2 — CID 90885046
2,5-bis(ethylsulfonyl)-3-methylhexa-2,4-dienediamide (PubChem CID 90885046) has the molecular formula C11H18N2O6S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2,5-bis(ethylsulfonyl)-3-methylhexa-2,4-dienediamide.
| Compound Name | 2,5-bis(ethylsulfonyl)-3-methylhexa-2,4-dienediamide |
|---|---|
| PubChem CID | 90885046 |
| Molecular Formula | C11H18N2O6S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2,5-bis(ethylsulfonyl)-3-methylhexa-2,4-dienediamide |
| SMILES | CCS(=O)(=O)C(=CC(C)=C(C(N)=O)S(=O)(=O)CC)C(N)=O |
| InChI | InChI=1S/C11H18N2O6S2/c1-4-20(16,17)8(10(12)14)6-7(3)9(11(13)15)21(18,19)5-2/h6H,4-5H2,1-3H3,(H2,12,14)(H2,13,15) |
| InChIKey | QCUWOXMITPXGFP-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 154.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|