About benzene;N-(methylaminomethyl)acetamide;propan-2-one
benzene;N-(methylaminomethyl)acetamide;propan-2-one (PubChem CID 90888197) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is benzene;N-(methylaminomethyl)acetamide;propan-2-one.
Molecular Properties
| Compound Name | benzene;N-(methylaminomethyl)acetamide;propan-2-one |
| PubChem CID | 90888197 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | benzene;N-(methylaminomethyl)acetamide;propan-2-one |
| SMILES | CC(C)=O.CNCNC(C)=O.c1ccccc1 |
| InChI | InChI=1S/C6H6.C4H10N2O.C3H6O/c1-2-4-6-5-3-1;1-4(7)6-3-5-2;1-3(2)4/h1-6H;5H,3H2,1-2H3,(H,6,7);1-2H3 |
| InChIKey | FUHKSGZFKWGCGI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze benzene;N-(methylaminomethyl)acetamide;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N-(methylaminomethyl)acetamide;propan-2-one?
The IUPAC name of benzene;N-(methylaminomethyl)acetamide;propan-2-one (CID 90888197) is benzene;N-(methylaminomethyl)acetamide;propan-2-one.
What is the SMILES notation for benzene;N-(methylaminomethyl)acetamide;propan-2-one?
The canonical SMILES for benzene;N-(methylaminomethyl)acetamide;propan-2-one is CC(C)=O.CNCNC(C)=O.c1ccccc1.
What is the InChIKey of benzene;N-(methylaminomethyl)acetamide;propan-2-one?
The InChIKey is FUHKSGZFKWGCGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.C4H10N2O.C3H6O/c1-2-4-6-5-3-1;1-4(7)6-3-5-2;1-3(2)4/h1-6H;5H,3H2,1-2H3,(H,6,7);1-2H3.
What are the key properties of benzene;N-(methylaminomethyl)acetamide;propan-2-one?
benzene;N-(methylaminomethyl)acetamide;propan-2-one has a molecular weight of 238.33 g/mol, XLogP of 1.58, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N-(methylaminomethyl)acetamide;propan-2-one is sourced from PubChem (CID 90888197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).