About N-(acetamidomethyl)acetamide;benzene;propan-2-one
N-(acetamidomethyl)acetamide;benzene;propan-2-one (PubChem CID 90957295) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(acetamidomethyl)acetamide;benzene;propan-2-one.
Molecular Properties
| Compound Name | N-(acetamidomethyl)acetamide;benzene;propan-2-one |
| PubChem CID | 90957295 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-(acetamidomethyl)acetamide;benzene;propan-2-one |
| SMILES | CC(=O)NCNC(C)=O.CC(C)=O.c1ccccc1 |
| InChI | InChI=1S/C6H6.C5H10N2O2.C3H6O/c1-2-4-6-5-3-1;1-4(8)6-3-7-5(2)9;1-3(2)4/h1-6H;3H2,1-2H3,(H,6,8)(H,7,9);1-2H3 |
| InChIKey | KRVATQQQIJKXJK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(acetamidomethyl)acetamide;benzene;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(acetamidomethyl)acetamide;benzene;propan-2-one?
The IUPAC name of N-(acetamidomethyl)acetamide;benzene;propan-2-one (CID 90957295) is N-(acetamidomethyl)acetamide;benzene;propan-2-one.
What is the SMILES notation for N-(acetamidomethyl)acetamide;benzene;propan-2-one?
The canonical SMILES for N-(acetamidomethyl)acetamide;benzene;propan-2-one is CC(=O)NCNC(C)=O.CC(C)=O.c1ccccc1.
What is the InChIKey of N-(acetamidomethyl)acetamide;benzene;propan-2-one?
The InChIKey is KRVATQQQIJKXJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.C5H10N2O2.C3H6O/c1-2-4-6-5-3-1;1-4(8)6-3-7-5(2)9;1-3(2)4/h1-6H;3H2,1-2H3,(H,6,8)(H,7,9);1-2H3.
What are the key properties of N-(acetamidomethyl)acetamide;benzene;propan-2-one?
N-(acetamidomethyl)acetamide;benzene;propan-2-one has a molecular weight of 266.34 g/mol, XLogP of 1.50, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(acetamidomethyl)acetamide;benzene;propan-2-one is sourced from PubChem (CID 90957295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).