C15H18N4O3S — CID 9088832
N'-[(2R)-2-(2,3-dimethylphenoxy)propanoyl]-4-methylthiadiazole-5-carbohydrazide (PubChem CID 9088832) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is N'-[(2R)-2-(2,3-dimethylphenoxy)propanoyl]-4-methylthiadiazole-5-carbohydrazide.
| Compound Name | N'-[(2R)-2-(2,3-dimethylphenoxy)propanoyl]-4-methylthiadiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 9088832 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N'-[(2R)-2-(2,3-dimethylphenoxy)propanoyl]-4-methylthiadiazole-5-carbohydrazide |
| SMILES | Cc1cccc(O[C@H](C)C(=O)NNC(=O)c2snnc2C)c1C |
| InChI | InChI=1S/C15H18N4O3S/c1-8-6-5-7-12(9(8)2)22-11(4)14(20)17-18-15(21)13-10(3)16-19-23-13/h5-7,11H,1-4H3,(H,17,20)(H,18,21)/t11-/m1/s1 |
| InChIKey | DCVSKPPERLJJRO-LLVKDONJSA-N |
| XLogP | 1.69 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|