C16H16Br2N2O3S — CID 24634651
4,5-dibromo-N'-[2-(2,3-dimethylphenoxy)propanoyl]thiophene-2-carbohydrazide (PubChem CID 24634651) has the molecular formula C16H16Br2N2O3S and a molecular weight of 476.19 g/mol. Its IUPAC name is 4,5-dibromo-N'-[2-(2,3-dimethylphenoxy)propanoyl]thiophene-2-carbohydrazide.
| Compound Name | 4,5-dibromo-N'-[2-(2,3-dimethylphenoxy)propanoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 24634651 |
| Molecular Formula | C16H16Br2N2O3S |
| Molecular Weight | 476.19 g/mol |
| Exact Mass | 473.92 |
| IUPAC Name | 4,5-dibromo-N'-[2-(2,3-dimethylphenoxy)propanoyl]thiophene-2-carbohydrazide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)c2cc(Br)c(Br)s2)c1C |
| InChI | InChI=1S/C16H16Br2N2O3S/c1-8-5-4-6-12(9(8)2)23-10(3)15(21)19-20-16(22)13-7-11(17)14(18)24-13/h4-7,10H,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | ZHLYMZFFQMWSLC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.19 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|