C9H13NS — CID 90890793
1-(1-thionitrosopropyl)cyclohexa-1,3-diene (PubChem CID 90890793) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is 1-(1-thionitrosopropyl)cyclohexa-1,3-diene.
| Compound Name | 1-(1-thionitrosopropyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 90890793 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 1-(1-thionitrosopropyl)cyclohexa-1,3-diene |
| SMILES | CCC(N=S)C1=CC=CCC1 |
| InChI | InChI=1S/C9H13NS/c1-2-9(10-11)8-6-4-3-5-7-8/h3-4,6,9H,2,5,7H2,1H3 |
| InChIKey | LBOZBFFGBUFQSG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |