C13H19N — CID 143636436
5-[(3Z,5Z)-hepta-3,5-dienyl]cyclohexa-2,4-dien-1-amine (PubChem CID 143636436) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 5-[(3Z,5Z)-hepta-3,5-dienyl]cyclohexa-2,4-dien-1-amine.
| Compound Name | 5-[(3Z,5Z)-hepta-3,5-dienyl]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143636436 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 5-[(3Z,5Z)-hepta-3,5-dienyl]cyclohexa-2,4-dien-1-amine |
| SMILES | C/C=C\C=C/CCC1=CC=CC(N)C1 |
| InChI | InChI=1S/C13H19N/c1-2-3-4-5-6-8-12-9-7-10-13(14)11-12/h2-5,7,9-10,13H,6,8,11,14H2,1H3/b3-2-,5-4- |
| InChIKey | MHYPFKDFHHWFHX-LDIADDGTSA-N |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|