C19H27N — CID 121373967
(2E,4E,6E)-6-[3-(cyclohexen-1-yl)cyclohex-2-en-1-ylidene]-3-methylhexa-2,4-dien-1-amine (PubChem CID 121373967) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is (2E,4E,6E)-6-[3-(cyclohexen-1-yl)cyclohex-2-en-1-ylidene]-3-methylhexa-2,4-dien-1-amine.
| Compound Name | (2E,4E,6E)-6-[3-(cyclohexen-1-yl)cyclohex-2-en-1-ylidene]-3-methylhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 121373967 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | (2E,4E,6E)-6-[3-(cyclohexen-1-yl)cyclohex-2-en-1-ylidene]-3-methylhexa-2,4-dien-1-amine |
| SMILES | CC(/C=C/C=C1/C=C(C2=CCCCC2)CCC1)=C\CN |
| InChI | InChI=1S/C19H27N/c1-16(13-14-20)7-5-8-17-9-6-12-19(15-17)18-10-3-2-4-11-18/h5,7-8,10,13,15H,2-4,6,9,11-12,14,20H2,1H3/b7-5+,16-13+,17-8+ |
| InChIKey | PLXPTUWLJNJXOJ-OTLMWCFISA-N |
| XLogP | 4.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|