C10H16N2 — CID 90891375
2,3,5,5,7-pentamethyl-1,4-diazepine (PubChem CID 90891375) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2,3,5,5,7-pentamethyl-1,4-diazepine.
| Compound Name | 2,3,5,5,7-pentamethyl-1,4-diazepine |
|---|---|
| PubChem CID | 90891375 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2,3,5,5,7-pentamethyl-1,4-diazepine |
| SMILES | CC1=CC(C)(C)N=C(C)C(C)=N1 |
| InChI | InChI=1S/C10H16N2/c1-7-6-10(4,5)12-9(3)8(2)11-7/h6H,1-5H3 |
| InChIKey | KLDIWRHRFQIMEB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |