C13H22N2 — CID 142254167
5-ethenyl-2,5,7-trimethyl-1,4-diazepine;propane (PubChem CID 142254167) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 5-ethenyl-2,5,7-trimethyl-1,4-diazepine;propane.
| Compound Name | 5-ethenyl-2,5,7-trimethyl-1,4-diazepine;propane |
|---|---|
| PubChem CID | 142254167 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 5-ethenyl-2,5,7-trimethyl-1,4-diazepine;propane |
| SMILES | C=CC1(C)C=C(C)N=C(C)C=N1.CCC |
| InChI | InChI=1S/C10H14N2.C3H8/c1-5-10(4)6-8(2)12-9(3)7-11-10;1-3-2/h5-7H,1H2,2-4H3;3H2,1-2H3 |
| InChIKey | XSDADNIWRHPHJF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|