C11H20N2 — CID 142254165
ethane;2,5,5,7-tetramethyl-1,4-diazepine (PubChem CID 142254165) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is ethane;2,5,5,7-tetramethyl-1,4-diazepine.
| Compound Name | ethane;2,5,5,7-tetramethyl-1,4-diazepine |
|---|---|
| PubChem CID | 142254165 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | ethane;2,5,5,7-tetramethyl-1,4-diazepine |
| SMILES | CC.CC1=CC(C)(C)N=CC(C)=N1 |
| InChI | InChI=1S/C9H14N2.C2H6/c1-7-5-9(3,4)10-6-8(2)11-7;1-2/h5-6H,1-4H3;1-2H3 |
| InChIKey | AHYJKKDYGRLMNK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |