C17H17N3O4S2 — CID 9089372
N-[2-oxo-2-[2-[(E)-3-phenylsulfanylprop-2-enoyl]hydrazinyl]ethyl]benzenesulfonamide (PubChem CID 9089372) has the molecular formula C17H17N3O4S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[2-oxo-2-[2-[(E)-3-phenylsulfanylprop-2-enoyl]hydrazinyl]ethyl]benzenesulfonamide.
| Compound Name | N-[2-oxo-2-[2-[(E)-3-phenylsulfanylprop-2-enoyl]hydrazinyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9089372 |
| Molecular Formula | C17H17N3O4S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | N-[2-oxo-2-[2-[(E)-3-phenylsulfanylprop-2-enoyl]hydrazinyl]ethyl]benzenesulfonamide |
| SMILES | O=C(/C=C/Sc1ccccc1)NNC(=O)CNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O4S2/c21-16(11-12-25-14-7-3-1-4-8-14)19-20-17(22)13-18-26(23,24)15-9-5-2-6-10-15/h1-12,18H,13H2,(H,19,21)(H,20,22)/b12-11+ |
| InChIKey | SYFYGWRAVGNABF-VAWYXSNFSA-N |
| XLogP | 1.42 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|