C20H23N3O4S — CID 9089522
1-[[(2S)-2,3-dihydro-1-benzofuran-2-carbonyl]amino]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea (PubChem CID 9089522) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-[[(2S)-2,3-dihydro-1-benzofuran-2-carbonyl]amino]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea.
| Compound Name | 1-[[(2S)-2,3-dihydro-1-benzofuran-2-carbonyl]amino]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 9089522 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 1-[[(2S)-2,3-dihydro-1-benzofuran-2-carbonyl]amino]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea |
| SMILES | COc1ccc(CCNC(=S)NNC(=O)[C@@H]2Cc3ccccc3O2)cc1OC |
| InChI | InChI=1S/C20H23N3O4S/c1-25-16-8-7-13(11-17(16)26-2)9-10-21-20(28)23-22-19(24)18-12-14-5-3-4-6-15(14)27-18/h3-8,11,18H,9-10,12H2,1-2H3,(H,22,24)(H2,21,23,28)/t18-/m0/s1 |
| InChIKey | LGQDITYTMPSRTO-SFHVURJKSA-N |
| XLogP | 1.75 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|