C19H19N3O5 — CID 52521712
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[[(2S)-2,3-dihydro-1-benzofuran-2-carbonyl]amino]urea (PubChem CID 52521712) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[[(2S)-2,3-dihydro-1-benzofuran-2-carbonyl]amino]urea.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[[(2S)-2,3-dihydro-1-benzofuran-2-carbonyl]amino]urea |
|---|---|
| PubChem CID | 52521712 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[[(2S)-2,3-dihydro-1-benzofuran-2-carbonyl]amino]urea |
| SMILES | O=C(NCCc1ccc2c(c1)OCO2)NNC(=O)[C@@H]1Cc2ccccc2O1 |
| InChI | InChI=1S/C19H19N3O5/c23-18(17-10-13-3-1-2-4-14(13)27-17)21-22-19(24)20-8-7-12-5-6-15-16(9-12)26-11-25-15/h1-6,9,17H,7-8,10-11H2,(H,21,23)(H2,20,22,24)/t17-/m0/s1 |
| InChIKey | PGNMZJPGFLDEJV-KRWDZBQOSA-N |
| XLogP | 1.29 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|