C20H23N3O5 — CID 95143354
1-[[(2S)-2,3-dihydro-1-benzofuran-2-carbonyl]amino]-3-[2-(2-phenoxyethoxy)ethyl]urea (PubChem CID 95143354) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-[[(2S)-2,3-dihydro-1-benzofuran-2-carbonyl]amino]-3-[2-(2-phenoxyethoxy)ethyl]urea.
| Compound Name | 1-[[(2S)-2,3-dihydro-1-benzofuran-2-carbonyl]amino]-3-[2-(2-phenoxyethoxy)ethyl]urea |
|---|---|
| PubChem CID | 95143354 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-[[(2S)-2,3-dihydro-1-benzofuran-2-carbonyl]amino]-3-[2-(2-phenoxyethoxy)ethyl]urea |
| SMILES | O=C(NCCOCCOc1ccccc1)NNC(=O)[C@@H]1Cc2ccccc2O1 |
| InChI | InChI=1S/C20H23N3O5/c24-19(18-14-15-6-4-5-9-17(15)28-18)22-23-20(25)21-10-11-26-12-13-27-16-7-2-1-3-8-16/h1-9,18H,10-14H2,(H,22,24)(H2,21,23,25)/t18-/m0/s1 |
| InChIKey | YGFVOPTZKNOUFN-SFHVURJKSA-N |
| XLogP | 1.42 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|