C10H15NO5 — CID 90896548
methyl 1-(2,2-dihydroxyethyl)-3-methyl-4-oxo-2,3-dihydropyridine-2-carboxylate (PubChem CID 90896548) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is methyl 1-(2,2-dihydroxyethyl)-3-methyl-4-oxo-2,3-dihydropyridine-2-carboxylate.
| Compound Name | methyl 1-(2,2-dihydroxyethyl)-3-methyl-4-oxo-2,3-dihydropyridine-2-carboxylate |
|---|---|
| PubChem CID | 90896548 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | methyl 1-(2,2-dihydroxyethyl)-3-methyl-4-oxo-2,3-dihydropyridine-2-carboxylate |
| SMILES | COC(=O)C1C(C)C(=O)C=CN1CC(O)O |
| InChI | InChI=1S/C10H15NO5/c1-6-7(12)3-4-11(5-8(13)14)9(6)10(15)16-2/h3-4,6,8-9,13-14H,5H2,1-2H3 |
| InChIKey | KLTKEOKIHVFBKC-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|