C23H36N2O2S — CID 90897078
2-[[4-[4-(1-propan-2-ylpiperidin-4-yl)oxyphenyl]oxan-4-yl]methyl]-1,2-thiazolidine (PubChem CID 90897078) has the molecular formula C23H36N2O2S and a molecular weight of 404.62 g/mol. Its IUPAC name is 2-[[4-[4-(1-propan-2-ylpiperidin-4-yl)oxyphenyl]oxan-4-yl]methyl]-1,2-thiazolidine.
| Compound Name | 2-[[4-[4-(1-propan-2-ylpiperidin-4-yl)oxyphenyl]oxan-4-yl]methyl]-1,2-thiazolidine |
|---|---|
| PubChem CID | 90897078 |
| Molecular Formula | C23H36N2O2S |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 2-[[4-[4-(1-propan-2-ylpiperidin-4-yl)oxyphenyl]oxan-4-yl]methyl]-1,2-thiazolidine |
| SMILES | CC(C)N1CCC(Oc2ccc(C3(CN4CCCS4)CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C23H36N2O2S/c1-19(2)24-13-8-22(9-14-24)27-21-6-4-20(5-7-21)23(10-15-26-16-11-23)18-25-12-3-17-28-25/h4-7,19,22H,3,8-18H2,1-2H3 |
| InChIKey | AICPLPWYBKLCKW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|