C13H18O2 — CID 90897305
2-cyclopentyloxy-3-methylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 90897305) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-cyclopentyloxy-3-methylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 2-cyclopentyloxy-3-methylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 90897305 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-cyclopentyloxy-3-methylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CC1=CCCC(C=O)=C1OC1CCCC1 |
| InChI | InChI=1S/C13H18O2/c1-10-5-4-6-11(9-14)13(10)15-12-7-2-3-8-12/h5,9,12H,2-4,6-8H2,1H3 |
| InChIKey | DSCFGVFNIIIYAQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|