C9H16NS+ — CID 90898073
2,4,5-trimethyl-1-propyl-1,3-thiazol-1-ium (PubChem CID 90898073) has the molecular formula C9H16NS+ and a molecular weight of 170.30 g/mol. Its IUPAC name is 2,4,5-trimethyl-1-propyl-1,3-thiazol-1-ium.
| Compound Name | 2,4,5-trimethyl-1-propyl-1,3-thiazol-1-ium |
|---|---|
| PubChem CID | 90898073 |
| Molecular Formula | C9H16NS+ |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.10 |
| IUPAC Name | 2,4,5-trimethyl-1-propyl-1,3-thiazol-1-ium |
| SMILES | CCC[s+]1c(C)nc(C)c1C |
| InChI | InChI=1S/C9H16NS/c1-5-6-11-8(3)7(2)10-9(11)4/h5-6H2,1-4H3/q+1 |
| InChIKey | NEDKCLALIYPSPL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|