C11H20NS+ — CID 91425404
2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium (PubChem CID 91425404) has the molecular formula C11H20NS+ and a molecular weight of 198.35 g/mol. Its IUPAC name is 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium.
| Compound Name | 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium |
|---|---|
| PubChem CID | 91425404 |
| Molecular Formula | C11H20NS+ |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium |
| SMILES | CCCCC[s+]1c(C)nc(C)c1C |
| InChI | InChI=1S/C11H20NS/c1-5-6-7-8-13-10(3)9(2)12-11(13)4/h5-8H2,1-4H3/q+1 |
| InChIKey | ABSSYCUQYPDMIQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|