About 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium
2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium (PubChem CID 91425404) has the molecular formula C11H20NS+
and a molecular weight of 198.35 g/mol. Its IUPAC name is 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium.
Molecular Properties
| Compound Name | 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium |
| PubChem CID | 91425404 |
| Molecular Formula | C11H20NS+ |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium |
| SMILES | CCCCC[s+]1c(C)nc(C)c1C |
| InChI | InChI=1S/C11H20NS/c1-5-6-7-8-13-10(3)9(2)12-11(13)4/h5-8H2,1-4H3/q+1 |
| InChIKey | ABSSYCUQYPDMIQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium?
The IUPAC name of 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium (CID 91425404) is 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium.
What is the SMILES notation for 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium?
The canonical SMILES for 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium is CCCCC[s+]1c(C)nc(C)c1C.
What is the InChIKey of 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium?
The InChIKey is ABSSYCUQYPDMIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20NS/c1-5-6-7-8-13-10(3)9(2)12-11(13)4/h5-8H2,1-4H3/q+1.
What are the key properties of 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium?
2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium has a molecular weight of 198.35 g/mol, XLogP of 3.95, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trimethyl-1-pentyl-1,3-thiazol-1-ium is sourced from PubChem (CID 91425404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).