C21H30N3O2+ — CID 9089882
tert-butyl-[3-[[2-[(2-naphthalen-1-ylacetyl)amino]acetyl]amino]propyl]azanium (PubChem CID 9089882) has the molecular formula C21H30N3O2+ and a molecular weight of 356.49 g/mol. Its IUPAC name is tert-butyl-[3-[[2-[(2-naphthalen-1-ylacetyl)amino]acetyl]amino]propyl]azanium.
| Compound Name | tert-butyl-[3-[[2-[(2-naphthalen-1-ylacetyl)amino]acetyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 9089882 |
| Molecular Formula | C21H30N3O2+ |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | tert-butyl-[3-[[2-[(2-naphthalen-1-ylacetyl)amino]acetyl]amino]propyl]azanium |
| SMILES | CC(C)(C)[NH2+]CCCNC(=O)CNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H29N3O2/c1-21(2,3)24-13-7-12-22-20(26)15-23-19(25)14-17-10-6-9-16-8-4-5-11-18(16)17/h4-6,8-11,24H,7,12-15H2,1-3H3,(H,22,26)(H,23,25)/p+1 |
| InChIKey | HINVMXUFLLXSFD-UHFFFAOYSA-O |
| XLogP | 1.37 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|