C19H22N2O3 — CID 90900163
5-[3-[1-(1,3-benzodioxol-4-yl)ethylamino]cyclopentyl]-1H-pyridin-2-one (PubChem CID 90900163) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-[3-[1-(1,3-benzodioxol-4-yl)ethylamino]cyclopentyl]-1H-pyridin-2-one.
| Compound Name | 5-[3-[1-(1,3-benzodioxol-4-yl)ethylamino]cyclopentyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 90900163 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 5-[3-[1-(1,3-benzodioxol-4-yl)ethylamino]cyclopentyl]-1H-pyridin-2-one |
| SMILES | CC(NC1CCC(c2ccc(=O)[nH]c2)C1)c1cccc2c1OCO2 |
| InChI | InChI=1S/C19H22N2O3/c1-12(16-3-2-4-17-19(16)24-11-23-17)21-15-7-5-13(9-15)14-6-8-18(22)20-10-14/h2-4,6,8,10,12-13,15,21H,5,7,9,11H2,1H3,(H,20,22) |
| InChIKey | AXPMJZJBNBZDJO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |