C28H30Cl2N2O4S — CID 90901145
3-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-6-[2-(3-chloro-4-propan-2-yloxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione (PubChem CID 90901145) has the molecular formula C28H30Cl2N2O4S and a molecular weight of 561.53 g/mol. Its IUPAC name is 3-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-6-[2-(3-chloro-4-propan-2-yloxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione.
| Compound Name | 3-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-6-[2-(3-chloro-4-propan-2-yloxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione |
|---|---|
| PubChem CID | 90901145 |
| Molecular Formula | C28H30Cl2N2O4S |
| Molecular Weight | 561.53 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | 3-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-6-[2-(3-chloro-4-propan-2-yloxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione |
| SMILES | CC(C)Oc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3nc4ccc(Cl)cc4[nH]3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C28H30Cl2N2O4S/c1-16(2)35-24-10-7-17(13-20(24)30)11-12-28(18-5-3-4-6-18)15-23(33)25(26(34)36-28)37-27-31-21-9-8-19(29)14-22(21)32-27/h7-10,13-14,16,18,25H,3-6,11-12,15H2,1-2H3,(H,31,32) |
| InChIKey | CHAUXKRJDOSMFW-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|