C23H33N3O4 — CID 90902228
4-[4-(2-adamantylcarbamoyl)-5-(2-methylpropoxy)pyrazol-1-yl]-2-methylbut-2-enoic acid (PubChem CID 90902228) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is 4-[4-(2-adamantylcarbamoyl)-5-(2-methylpropoxy)pyrazol-1-yl]-2-methylbut-2-enoic acid.
| Compound Name | 4-[4-(2-adamantylcarbamoyl)-5-(2-methylpropoxy)pyrazol-1-yl]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 90902228 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 4-[4-(2-adamantylcarbamoyl)-5-(2-methylpropoxy)pyrazol-1-yl]-2-methylbut-2-enoic acid |
| SMILES | CC(=CCn1ncc(C(=O)NC2C3CC4CC(C3)CC2C4)c1OCC(C)C)C(=O)O |
| InChI | InChI=1S/C23H33N3O4/c1-13(2)12-30-22-19(11-24-26(22)5-4-14(3)23(28)29)21(27)25-20-17-7-15-6-16(9-17)10-18(20)8-15/h4,11,13,15-18,20H,5-10,12H2,1-3H3,(H,25,27)(H,28,29) |
| InChIKey | WIRXGOWPGDKYER-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|