C12H6F7NO2 — CID 90903060
[cyano(phenyl)methyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 90903060) has the molecular formula C12H6F7NO2 and a molecular weight of 329.17 g/mol. Its IUPAC name is [cyano(phenyl)methyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [cyano(phenyl)methyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 90903060 |
| Molecular Formula | C12H6F7NO2 |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | [cyano(phenyl)methyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | N#CC(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H6F7NO2/c13-10(14,11(15,16)12(17,18)19)9(21)22-8(6-20)7-4-2-1-3-5-7/h1-5,8H |
| InChIKey | YUTWZECVBWFQSJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|