C43H75NO4 — CID 90904006
6-(methylaminomethyl)-2,2-bis(octadeca-9,12-dienyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 90904006) has the molecular formula C43H75NO4 and a molecular weight of 670.08 g/mol. Its IUPAC name is 6-(methylaminomethyl)-2,2-bis(octadeca-9,12-dienyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | 6-(methylaminomethyl)-2,2-bis(octadeca-9,12-dienyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 90904006 |
| Molecular Formula | C43H75NO4 |
| Molecular Weight | 670.08 g/mol |
| Exact Mass | 669.57 |
| IUPAC Name | 6-(methylaminomethyl)-2,2-bis(octadeca-9,12-dienyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | CCCCCC=CCC=CCCCCCCCCC1(CCCCCCCCC=CCC=CCCCCC)OC2C(=O)OC(CNC)C2O1 |
| InChI | InChI=1S/C43H75NO4/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-43(47-40-39(38-44-3)46-42(45)41(40)48-43)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,39-41,44H,4-11,16-17,22-38H2,1-3H3 |
| InChIKey | FLHQWDCBYFBJDK-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.08 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|