C44H77NO4 — CID 71217324
(3aR,6R,6aR)-6-[(dimethylamino)methyl]-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 71217324) has the molecular formula C44H77NO4 and a molecular weight of 684.10 g/mol. Its IUPAC name is (3aR,6R,6aR)-6-[(dimethylamino)methyl]-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aR,6R,6aR)-6-[(dimethylamino)methyl]-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 71217324 |
| Molecular Formula | C44H77NO4 |
| Molecular Weight | 684.10 g/mol |
| Exact Mass | 683.59 |
| IUPAC Name | (3aR,6R,6aR)-6-[(dimethylamino)methyl]-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)O[C@@H]2[C@@H](CN(C)C)OC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C44H77NO4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-44(48-41-40(39-45(3)4)47-43(46)42(41)49-44)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,40-42H,5-12,17-18,23-39H2,1-4H3/b15-13-,16-14-,21-19-,22-20-/t40-,41-,42-/m1/s1 |
| InChIKey | OWJYABBKJSGLSI-BPXBUVMHSA-N |
| XLogP | 12.36 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.10 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|