C13H21N5O5S — CID 90905406
2-amino-9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)thiolan-2-yl]-2,3-dihydro-1H-purin-6-one (PubChem CID 90905406) has the molecular formula C13H21N5O5S and a molecular weight of 359.41 g/mol. Its IUPAC name is 2-amino-9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)thiolan-2-yl]-2,3-dihydro-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)thiolan-2-yl]-2,3-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 90905406 |
| Molecular Formula | C13H21N5O5S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-amino-9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)thiolan-2-yl]-2,3-dihydro-1H-purin-6-one |
| SMILES | COCCOC1[C@@H](O)[C@@H](CO)S[C@H]1n1cnc2c1NC(N)NC2=O |
| InChI | InChI=1S/C13H21N5O5S/c1-22-2-3-23-9-8(20)6(4-19)24-12(9)18-5-15-7-10(18)16-13(14)17-11(7)21/h5-6,8-9,12-13,16,19-20H,2-4,14H2,1H3,(H,17,21)/t6-,8+,9?,12-,13?/m1/s1 |
| InChIKey | VSGJPXUUUGOYCU-HZGNGHQASA-N |
| XLogP | -1.72 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|