C19H23N5O8 — CID 162081373
9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)oxolan-2-yl]-1H-purin-6-one;nitrobenzene (PubChem CID 162081373) has the molecular formula C19H23N5O8 and a molecular weight of 449.42 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)oxolan-2-yl]-1H-purin-6-one;nitrobenzene.
| Compound Name | 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)oxolan-2-yl]-1H-purin-6-one;nitrobenzene |
|---|---|
| PubChem CID | 162081373 |
| Molecular Formula | C19H23N5O8 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)oxolan-2-yl]-1H-purin-6-one;nitrobenzene |
| SMILES | COCCO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(=O)[nH]cnc21.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C13H18N4O6.C6H5NO2/c1-21-2-3-22-10-9(19)7(4-18)23-13(10)17-6-16-8-11(17)14-5-15-12(8)20;8-7(9)6-4-2-1-3-5-6/h5-7,9-10,13,18-19H,2-4H2,1H3,(H,14,15,20);1-5H/t7-,9-,10-,13-;/m1./s1 |
| InChIKey | ZCJSAEHUZGDJQN-AZUPYXJKSA-N |
| XLogP | -0.00 |
| TPSA | 174.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|