C33H30F2N2O3 — CID 90905504
1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-methoxyiminopropyl]-4-(4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)azetidin-2-one (PubChem CID 90905504) has the molecular formula C33H30F2N2O3 and a molecular weight of 540.61 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-methoxyiminopropyl]-4-(4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)azetidin-2-one.
| Compound Name | 1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-methoxyiminopropyl]-4-(4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)azetidin-2-one |
|---|---|
| PubChem CID | 90905504 |
| Molecular Formula | C33H30F2N2O3 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-methoxyiminopropyl]-4-(4-phenylmethoxycyclohepta-1,3,5-trien-1-yl)azetidin-2-one |
| SMILES | CON=C(CCC1C(=O)N(c2ccc(F)cc2)C1C1=CC=C(OCc2ccccc2)C=CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C33H30F2N2O3/c1-39-36-31(24-10-13-26(34)14-11-24)21-20-30-32(37(33(30)38)28-17-15-27(35)16-18-28)25-8-5-9-29(19-12-25)40-22-23-6-3-2-4-7-23/h2-7,9-19,30,32H,8,20-22H2,1H3 |
| InChIKey | PTDHCVBHUMDQOY-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|