C9H16N2 — CID 90908553
1-buta-2,3-dien-2-yl-4-methylpiperazine (PubChem CID 90908553) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-buta-2,3-dien-2-yl-4-methylpiperazine.
| Compound Name | 1-buta-2,3-dien-2-yl-4-methylpiperazine |
|---|---|
| PubChem CID | 90908553 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-buta-2,3-dien-2-yl-4-methylpiperazine |
| SMILES | C=C=C(C)N1CCN(C)CC1 |
| InChI | InChI=1S/C9H16N2/c1-4-9(2)11-7-5-10(3)6-8-11/h1,5-8H2,2-3H3 |
| InChIKey | MUBLPJZKWZMKRU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |