C22H30 — CID 90909135
2-(2-methylphenyl)-1,3,5-tripropylbenzene (PubChem CID 90909135) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1,3,5-tripropylbenzene.
| Compound Name | 2-(2-methylphenyl)-1,3,5-tripropylbenzene |
|---|---|
| PubChem CID | 90909135 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 2-(2-methylphenyl)-1,3,5-tripropylbenzene |
| SMILES | CCCc1cc(CCC)c(-c2ccccc2C)c(CCC)c1 |
| InChI | InChI=1S/C22H30/c1-5-10-18-15-19(11-6-2)22(20(16-18)12-7-3)21-14-9-8-13-17(21)4/h8-9,13-16H,5-7,10-12H2,1-4H3 |
| InChIKey | MKVMCMZHHCHXLE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |