C31H38O — CID 145234694
(8S)-3,8-dimethyl-5,12,14-tripropyltetracyclo[14.3.1.02,7.010,15]icosa-1(20),2(7),3,5,10(15),11,13,16,18-nonaen-20-ol (PubChem CID 145234694) has the molecular formula C31H38O and a molecular weight of 426.64 g/mol. Its IUPAC name is (8S)-3,8-dimethyl-5,12,14-tripropyltetracyclo[14.3.1.02,7.010,15]icosa-1(20),2(7),3,5,10(15),11,13,16,18-nonaen-20-ol.
| Compound Name | (8S)-3,8-dimethyl-5,12,14-tripropyltetracyclo[14.3.1.02,7.010,15]icosa-1(20),2(7),3,5,10(15),11,13,16,18-nonaen-20-ol |
|---|---|
| PubChem CID | 145234694 |
| Molecular Formula | C31H38O |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | (8S)-3,8-dimethyl-5,12,14-tripropyltetracyclo[14.3.1.02,7.010,15]icosa-1(20),2(7),3,5,10(15),11,13,16,18-nonaen-20-ol |
| SMILES | CCCc1cc(CCC)c2c(c1)C[C@H](C)c1cc(CCC)cc(C)c1-c1cccc-2c1O |
| InChI | InChI=1S/C31H38O/c1-6-10-22-15-21(5)29-26-13-9-14-27(31(26)32)30-24(12-8-3)17-23(11-7-2)18-25(30)16-20(4)28(29)19-22/h9,13-15,17-20,32H,6-8,10-12,16H2,1-5H3/t20-/m0/s1 |
| InChIKey | DCNKOAXEMBFEMZ-FQEVSTJZSA-N |
| XLogP | 8.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |