C19H23N3O4 — CID 90913461
benzyl (4aS,7S)-1-amino-7-(2-formyloxyethyl)-3-methyl-4a,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 90913461) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is benzyl (4aS,7S)-1-amino-7-(2-formyloxyethyl)-3-methyl-4a,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | benzyl (4aS,7S)-1-amino-7-(2-formyloxyethyl)-3-methyl-4a,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 90913461 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | benzyl (4aS,7S)-1-amino-7-(2-formyloxyethyl)-3-methyl-4a,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)[C@@H]2CC[C@@H](CCOC=O)N2C(N)=N1 |
| InChI | InChI=1S/C19H23N3O4/c1-13-17(18(24)26-11-14-5-3-2-4-6-14)16-8-7-15(9-10-25-12-23)22(16)19(20)21-13/h2-6,12,15-16H,7-11H2,1H3,(H2,20,21)/t15-,16-/m0/s1 |
| InChIKey | DEXOMHWDKHFCQF-HOTGVXAUSA-N |
| XLogP | 1.73 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|