C35H41N3O6S — CID 177458123
benzyl (1Z,4aS,7S)-1-(4-methoxy-2,3,6-trimethylphenyl)sulfonylimino-3-methyl-7-(2-phenylmethoxyethyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 177458123) has the molecular formula C35H41N3O6S and a molecular weight of 631.80 g/mol. Its IUPAC name is benzyl (1Z,4aS,7S)-1-(4-methoxy-2,3,6-trimethylphenyl)sulfonylimino-3-methyl-7-(2-phenylmethoxyethyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | benzyl (1Z,4aS,7S)-1-(4-methoxy-2,3,6-trimethylphenyl)sulfonylimino-3-methyl-7-(2-phenylmethoxyethyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 177458123 |
| Molecular Formula | C35H41N3O6S |
| Molecular Weight | 631.80 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | benzyl (1Z,4aS,7S)-1-(4-methoxy-2,3,6-trimethylphenyl)sulfonylimino-3-methyl-7-(2-phenylmethoxyethyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | COc1cc(C)c(S(=O)(=O)/N=C2/NC(C)=C(C(=O)OCc3ccccc3)[C@@H]3CC[C@@H](CCOCc4ccccc4)N23)c(C)c1C |
| InChI | InChI=1S/C35H41N3O6S/c1-23-20-31(42-5)24(2)25(3)33(23)45(40,41)37-35-36-26(4)32(34(39)44-22-28-14-10-7-11-15-28)30-17-16-29(38(30)35)18-19-43-21-27-12-8-6-9-13-27/h6-15,20,29-30H,16-19,21-22H2,1-5H3,(H,36,37)/t29-,30-/m0/s1 |
| InChIKey | DVDSUCXOCXHDJA-KYJUHHDHSA-N |
| XLogP | 5.73 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.80 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|