C21H21ClN8O2S — CID 90916368
N-[1-[8-chloro-1-(4-methylsulfonylpiperazin-1-yl)isoquinolin-3-yl]ethyl]purin-6-amine (PubChem CID 90916368) has the molecular formula C21H21ClN8O2S and a molecular weight of 484.97 g/mol. Its IUPAC name is N-[1-[8-chloro-1-(4-methylsulfonylpiperazin-1-yl)isoquinolin-3-yl]ethyl]purin-6-amine.
| Compound Name | N-[1-[8-chloro-1-(4-methylsulfonylpiperazin-1-yl)isoquinolin-3-yl]ethyl]purin-6-amine |
|---|---|
| PubChem CID | 90916368 |
| Molecular Formula | C21H21ClN8O2S |
| Molecular Weight | 484.97 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | N-[1-[8-chloro-1-(4-methylsulfonylpiperazin-1-yl)isoquinolin-3-yl]ethyl]purin-6-amine |
| SMILES | CC(Nc1ncnc2c1N=C=N2)c1cc2cccc(Cl)c2c(N2CCN(S(C)(=O)=O)CC2)n1 |
| InChI | InChI=1S/C21H21ClN8O2S/c1-13(27-20-18-19(24-11-23-18)25-12-26-20)16-10-14-4-3-5-15(22)17(14)21(28-16)29-6-8-30(9-7-29)33(2,31)32/h3-5,10,12-13H,6-9H2,1-2H3,(H,25,26,27) |
| InChIKey | INXBKQARTMCDSV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 116.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.97 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |