C29H29N3O3 — CID 90916425
2-[2-[3-[[(3R)-3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]phenoxy]ethyl]benzoic acid (PubChem CID 90916425) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[2-[3-[[(3R)-3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]phenoxy]ethyl]benzoic acid.
| Compound Name | 2-[2-[3-[[(3R)-3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]phenoxy]ethyl]benzoic acid |
|---|---|
| PubChem CID | 90916425 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-[2-[3-[[(3R)-3-(isoquinolin-5-ylamino)pyrrolidin-1-yl]methyl]phenoxy]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CCOc1cccc(CN2CC[C@@H](Nc3cccc4cnccc34)C2)c1 |
| InChI | InChI=1S/C29H29N3O3/c33-29(34)27-9-2-1-6-22(27)13-16-35-25-8-3-5-21(17-25)19-32-15-12-24(20-32)31-28-10-4-7-23-18-30-14-11-26(23)28/h1-11,14,17-18,24,31H,12-13,15-16,19-20H2,(H,33,34)/t24-/m1/s1 |
| InChIKey | NAMDYWDLVDBDIR-XMMPIXPASA-N |
| XLogP | 5.24 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |