C32H55N2O+ — CID 90916777
butan-2-ylbenzene;2-(2-methylbutanoylamino)ethyl-tris(pent-4-enyl)azanium (PubChem CID 90916777) has the molecular formula C32H55N2O+ and a molecular weight of 483.81 g/mol. Its IUPAC name is butan-2-ylbenzene;2-(2-methylbutanoylamino)ethyl-tris(pent-4-enyl)azanium.
| Compound Name | butan-2-ylbenzene;2-(2-methylbutanoylamino)ethyl-tris(pent-4-enyl)azanium |
|---|---|
| PubChem CID | 90916777 |
| Molecular Formula | C32H55N2O+ |
| Molecular Weight | 483.81 g/mol |
| Exact Mass | 483.43 |
| IUPAC Name | butan-2-ylbenzene;2-(2-methylbutanoylamino)ethyl-tris(pent-4-enyl)azanium |
| SMILES | C=CCCC[N+](CCCC=C)(CCCC=C)CCNC(=O)C(C)CC.CCC(C)c1ccccc1 |
| InChI | InChI=1S/C22H40N2O.C10H14/c1-6-10-13-17-24(18-14-11-7-2,19-15-12-8-3)20-16-23-22(25)21(5)9-4;1-3-9(2)10-7-5-4-6-8-10/h6-8,21H,1-3,9-20H2,4-5H3;4-9H,3H2,1-2H3/p+1 |
| InChIKey | CCPQNSGYPKSQEI-UHFFFAOYSA-O |
| XLogP | 8.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.81 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|