C20H35NO2 — CID 91095688
butan-2-ylbenzene;N-(butan-2-yloxymethyl)-2-methylbutanamide (PubChem CID 91095688) has the molecular formula C20H35NO2 and a molecular weight of 321.50 g/mol. Its IUPAC name is butan-2-ylbenzene;N-(butan-2-yloxymethyl)-2-methylbutanamide.
| Compound Name | butan-2-ylbenzene;N-(butan-2-yloxymethyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 91095688 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.50 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | butan-2-ylbenzene;N-(butan-2-yloxymethyl)-2-methylbutanamide |
| SMILES | CCC(C)OCNC(=O)C(C)CC.CCC(C)c1ccccc1 |
| InChI | InChI=1S/C10H21NO2.C10H14/c1-5-8(3)10(12)11-7-13-9(4)6-2;1-3-9(2)10-7-5-4-6-8-10/h8-9H,5-7H2,1-4H3,(H,11,12);4-9H,3H2,1-2H3 |
| InChIKey | CLQWCJQKRZGTRO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|