C26H45NO11S — CID 90916948
[(2R)-2-acetyloxy-2-[(2S,3S,4R)-3,4-diacetyloxy-5-(dihexylsulfamoyl)oxolan-2-yl]ethyl] acetate (PubChem CID 90916948) has the molecular formula C26H45NO11S and a molecular weight of 579.71 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-2-[(2S,3S,4R)-3,4-diacetyloxy-5-(dihexylsulfamoyl)oxolan-2-yl]ethyl] acetate.
| Compound Name | [(2R)-2-acetyloxy-2-[(2S,3S,4R)-3,4-diacetyloxy-5-(dihexylsulfamoyl)oxolan-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 90916948 |
| Molecular Formula | C26H45NO11S |
| Molecular Weight | 579.71 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | [(2R)-2-acetyloxy-2-[(2S,3S,4R)-3,4-diacetyloxy-5-(dihexylsulfamoyl)oxolan-2-yl]ethyl] acetate |
| SMILES | CCCCCCN(CCCCCC)S(=O)(=O)C1O[C@@H]([C@@H](COC(C)=O)OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H45NO11S/c1-7-9-11-13-15-27(16-14-12-10-8-2)39(32,33)26-25(37-21(6)31)24(36-20(5)30)23(38-26)22(35-19(4)29)17-34-18(3)28/h22-26H,7-17H2,1-6H3/t22-,23+,24+,25-,26?/m1/s1 |
| InChIKey | FYWBKLHMVPHJJF-PPILAZRBSA-N |
| XLogP | 2.86 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.71 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|