C11H7BrN2O3 — CID 90916966
5-[bromo(phenyl)methylidene]-3-nitrosopyrrolidine-2,4-dione (PubChem CID 90916966) has the molecular formula C11H7BrN2O3 and a molecular weight of 295.09 g/mol. Its IUPAC name is 5-[bromo(phenyl)methylidene]-3-nitrosopyrrolidine-2,4-dione.
| Compound Name | 5-[bromo(phenyl)methylidene]-3-nitrosopyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 90916966 |
| Molecular Formula | C11H7BrN2O3 |
| Molecular Weight | 295.09 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 5-[bromo(phenyl)methylidene]-3-nitrosopyrrolidine-2,4-dione |
| SMILES | O=NC1C(=O)NC(=C(Br)c2ccccc2)C1=O |
| InChI | InChI=1S/C11H7BrN2O3/c12-7(6-4-2-1-3-5-6)8-10(15)9(14-17)11(16)13-8/h1-5,9H,(H,13,16) |
| InChIKey | CQVLKAHSQMEZKJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.09 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|