C17H23ClO3Si — CID 90918207
methyl (1S,6S)-6-(4-chlorophenyl)-4-trimethylsilyloxycyclohex-3-ene-1-carboxylate (PubChem CID 90918207) has the molecular formula C17H23ClO3Si and a molecular weight of 338.91 g/mol. Its IUPAC name is methyl (1S,6S)-6-(4-chlorophenyl)-4-trimethylsilyloxycyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,6S)-6-(4-chlorophenyl)-4-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 90918207 |
| Molecular Formula | C17H23ClO3Si |
| Molecular Weight | 338.91 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | methyl (1S,6S)-6-(4-chlorophenyl)-4-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC=C(O[Si](C)(C)C)C[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClO3Si/c1-20-17(19)15-10-9-14(21-22(2,3)4)11-16(15)12-5-7-13(18)8-6-12/h5-9,15-16H,10-11H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | AIYXQNYRGAGGIW-JKSUJKDBSA-N |
| XLogP | 4.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.91 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|