C12H25NO4Si — CID 90919291
3-[tert-butyl(dimethyl)silyl]oxy-2-(propoxyamino)prop-2-enoic acid (PubChem CID 90919291) has the molecular formula C12H25NO4Si and a molecular weight of 275.42 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2-(propoxyamino)prop-2-enoic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-(propoxyamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 90919291 |
| Molecular Formula | C12H25NO4Si |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-(propoxyamino)prop-2-enoic acid |
| SMILES | CCCONC(=CO[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H25NO4Si/c1-7-8-16-13-10(11(14)15)9-17-18(5,6)12(2,3)4/h9,13H,7-8H2,1-6H3,(H,14,15) |
| InChIKey | VLMMMMBWUKNFJC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|