C16H12Br3ClO — CID 90920518
2,2-dibromo-1-[4-[(5-bromo-2-chlorophenyl)methyl]phenyl]cyclopropan-1-ol (PubChem CID 90920518) has the molecular formula C16H12Br3ClO and a molecular weight of 495.44 g/mol. Its IUPAC name is 2,2-dibromo-1-[4-[(5-bromo-2-chlorophenyl)methyl]phenyl]cyclopropan-1-ol.
| Compound Name | 2,2-dibromo-1-[4-[(5-bromo-2-chlorophenyl)methyl]phenyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 90920518 |
| Molecular Formula | C16H12Br3ClO |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 491.81 |
| IUPAC Name | 2,2-dibromo-1-[4-[(5-bromo-2-chlorophenyl)methyl]phenyl]cyclopropan-1-ol |
| SMILES | OC1(c2ccc(Cc3cc(Br)ccc3Cl)cc2)CC1(Br)Br |
| InChI | InChI=1S/C16H12Br3ClO/c17-13-5-6-14(20)11(8-13)7-10-1-3-12(4-2-10)15(21)9-16(15,18)19/h1-6,8,21H,7,9H2 |
| InChIKey | SEDCKRXXOHPNPN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|