C22H26BrCl — CID 126545270
4-bromo-1-chloro-2-[[4-(4-ethyl-4-methylcyclohexyl)phenyl]methyl]benzene (PubChem CID 126545270) has the molecular formula C22H26BrCl and a molecular weight of 405.81 g/mol. Its IUPAC name is 4-bromo-1-chloro-2-[[4-(4-ethyl-4-methylcyclohexyl)phenyl]methyl]benzene.
| Compound Name | 4-bromo-1-chloro-2-[[4-(4-ethyl-4-methylcyclohexyl)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 126545270 |
| Molecular Formula | C22H26BrCl |
| Molecular Weight | 405.81 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 4-bromo-1-chloro-2-[[4-(4-ethyl-4-methylcyclohexyl)phenyl]methyl]benzene |
| SMILES | CCC1(C)CCC(c2ccc(Cc3cc(Br)ccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C22H26BrCl/c1-3-22(2)12-10-18(11-13-22)17-6-4-16(5-7-17)14-19-15-20(23)8-9-21(19)24/h4-9,15,18H,3,10-14H2,1-2H3 |
| InChIKey | BZKQKOHCEACNSX-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.81 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |