C13H20O7 — CID 90920700
6-[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]-2,5-dimethyl-6-oxohexa-2,4-dienoic acid (PubChem CID 90920700) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is 6-[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]-2,5-dimethyl-6-oxohexa-2,4-dienoic acid.
| Compound Name | 6-[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]-2,5-dimethyl-6-oxohexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 90920700 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 6-[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]-2,5-dimethyl-6-oxohexa-2,4-dienoic acid |
| SMILES | CC(=CC=C(C)C(=O)OCC(CO)(CO)CO)C(=O)O |
| InChI | InChI=1S/C13H20O7/c1-9(11(17)18)3-4-10(2)12(19)20-8-13(5-14,6-15)7-16/h3-4,14-16H,5-8H2,1-2H3,(H,17,18) |
| InChIKey | YBEDGMYCWVSBIP-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|