C11H12O3 — CID 90922063
ethyl 3-(3-oxatricyclo[4.1.0.02,4]heptan-2-yl)prop-2-ynoate (PubChem CID 90922063) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is ethyl 3-(3-oxatricyclo[4.1.0.02,4]heptan-2-yl)prop-2-ynoate.
| Compound Name | ethyl 3-(3-oxatricyclo[4.1.0.02,4]heptan-2-yl)prop-2-ynoate |
|---|---|
| PubChem CID | 90922063 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | ethyl 3-(3-oxatricyclo[4.1.0.02,4]heptan-2-yl)prop-2-ynoate |
| SMILES | CCOC(=O)C#CC12OC1CC1CC12 |
| InChI | InChI=1S/C11H12O3/c1-2-13-10(12)3-4-11-8-5-7(8)6-9(11)14-11/h7-9H,2,5-6H2,1H3 |
| InChIKey | IDGBVORHHDSTEO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|