C25H37N3O4 — CID 90922806
1-butyl-1-[3-(3-cyclopentyloxy-4-methoxyphenyl)-1-oxa-2-azaspiro[4.5]dec-3-en-8-yl]urea (PubChem CID 90922806) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is 1-butyl-1-[3-(3-cyclopentyloxy-4-methoxyphenyl)-1-oxa-2-azaspiro[4.5]dec-3-en-8-yl]urea.
| Compound Name | 1-butyl-1-[3-(3-cyclopentyloxy-4-methoxyphenyl)-1-oxa-2-azaspiro[4.5]dec-3-en-8-yl]urea |
|---|---|
| PubChem CID | 90922806 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 1-butyl-1-[3-(3-cyclopentyloxy-4-methoxyphenyl)-1-oxa-2-azaspiro[4.5]dec-3-en-8-yl]urea |
| SMILES | CCCCN(C(N)=O)C1CCC2(C=C(c3ccc(OC)c(OC4CCCC4)c3)NO2)CC1 |
| InChI | InChI=1S/C25H37N3O4/c1-3-4-15-28(24(26)29)19-11-13-25(14-12-19)17-21(27-32-25)18-9-10-22(30-2)23(16-18)31-20-7-5-6-8-20/h9-10,16-17,19-20,27H,3-8,11-15H2,1-2H3,(H2,26,29) |
| InChIKey | PLIGMRGXGOYBFQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |