C20H26N2O5 — CID 90729149
[2-[3-(3-cyclopentyloxy-4-methoxyphenyl)-5-methyl-2H-1,2-oxazol-5-yl]-2-iminoethyl] acetate (PubChem CID 90729149) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is [2-[3-(3-cyclopentyloxy-4-methoxyphenyl)-5-methyl-2H-1,2-oxazol-5-yl]-2-iminoethyl] acetate.
| Compound Name | [2-[3-(3-cyclopentyloxy-4-methoxyphenyl)-5-methyl-2H-1,2-oxazol-5-yl]-2-iminoethyl] acetate |
|---|---|
| PubChem CID | 90729149 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | [2-[3-(3-cyclopentyloxy-4-methoxyphenyl)-5-methyl-2H-1,2-oxazol-5-yl]-2-iminoethyl] acetate |
| SMILES | [H]/N=C(\COC(C)=O)C1(C)C=C(c2ccc(OC)c(OC3CCCC3)c2)NO1 |
| InChI | InChI=1S/C20H26N2O5/c1-13(23)25-12-19(21)20(2)11-16(22-27-20)14-8-9-17(24-3)18(10-14)26-15-6-4-5-7-15/h8-11,15,21-22H,4-7,12H2,1-3H3/b21-19+ |
| InChIKey | OWJHYBCVOVVTSA-XUTLUUPISA-N |
| XLogP | 3.23 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|